C22H32N2O3 — CID 166718104
methyl N-[2-[1-(3-tert-butylphenyl)-3-azabicyclo[3.1.0]hexane-3-carbonyl]butyl]carbamate (PubChem CID 166718104) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is methyl N-[2-[1-(3-tert-butylphenyl)-3-azabicyclo[3.1.0]hexane-3-carbonyl]butyl]carbamate.
| Compound Name | methyl N-[2-[1-(3-tert-butylphenyl)-3-azabicyclo[3.1.0]hexane-3-carbonyl]butyl]carbamate |
|---|---|
| PubChem CID | 166718104 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | methyl N-[2-[1-(3-tert-butylphenyl)-3-azabicyclo[3.1.0]hexane-3-carbonyl]butyl]carbamate |
| SMILES | CCC(CNC(=O)OC)C(=O)N1CC2CC2(c2cccc(C(C)(C)C)c2)C1 |
| InChI | InChI=1S/C22H32N2O3/c1-6-15(12-23-20(26)27-5)19(25)24-13-18-11-22(18,14-24)17-9-7-8-16(10-17)21(2,3)4/h7-10,15,18H,6,11-14H2,1-5H3,(H,23,26) |
| InChIKey | PGMYXJRVEKGGAS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |