C22H24F6N6O3 — CID 166718378
(5R)-11-(2,2-difluoroethoxymethyl)-4-[[4-fluoro-3-(trifluoromethyl)anilino]-hydroxymethyl]-5,13-dimethyl-4,8,9,12,13-pentazatricyclo[7.5.0.02,7]tetradeca-1,7,11-trien-14-one (PubChem CID 166718378) has the molecular formula C22H24F6N6O3 and a molecular weight of 534.46 g/mol. Its IUPAC name is (5R)-11-(2,2-difluoroethoxymethyl)-4-[[4-fluoro-3-(trifluoromethyl)anilino]-hydroxymethyl]-5,13-dimethyl-4,8,9,12,13-pentazatricyclo[7.5.0.02,7]tetradeca-1,7,11-trien-14-one.
| Compound Name | (5R)-11-(2,2-difluoroethoxymethyl)-4-[[4-fluoro-3-(trifluoromethyl)anilino]-hydroxymethyl]-5,13-dimethyl-4,8,9,12,13-pentazatricyclo[7.5.0.02,7]tetradeca-1,7,11-trien-14-one |
|---|---|
| PubChem CID | 166718378 |
| Molecular Formula | C22H24F6N6O3 |
| Molecular Weight | 534.46 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | (5R)-11-(2,2-difluoroethoxymethyl)-4-[[4-fluoro-3-(trifluoromethyl)anilino]-hydroxymethyl]-5,13-dimethyl-4,8,9,12,13-pentazatricyclo[7.5.0.02,7]tetradeca-1,7,11-trien-14-one |
| SMILES | C[C@@H]1Cc2nn3c(c2CN1C(O)Nc1ccc(F)c(C(F)(F)F)c1)C(=O)N(C)N=C(COCC(F)F)C3 |
| InChI | InChI=1S/C22H24F6N6O3/c1-11-5-17-14(8-33(11)21(36)29-12-3-4-16(23)15(6-12)22(26,27)28)19-20(35)32(2)30-13(7-34(19)31-17)9-37-10-18(24)25/h3-4,6,11,18,21,29,36H,5,7-10H2,1-2H3/t11-,21?/m1/s1 |
| InChIKey | WPGNNUWSYMQHJE-ZIFPNCEFSA-N |
| XLogP | 2.90 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|