C11H15N3O — CID 166718693
7-pentan-2-yl-2H-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 166718693) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 7-pentan-2-yl-2H-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 7-pentan-2-yl-2H-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 166718693 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 7-pentan-2-yl-2H-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | CCCC(C)c1ccn2c(=O)[nH]nc2c1 |
| InChI | InChI=1S/C11H15N3O/c1-3-4-8(2)9-5-6-14-10(7-9)12-13-11(14)15/h5-8H,3-4H2,1-2H3,(H,13,15) |
| InChIKey | QPOJMYHQQABCFH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |