About [5-ethenyl-3-methyl-4-[(1Z)-2-methylbuta-1,3-dienyl]pyrazol-1-yl] thiohypofluorite
[5-ethenyl-3-methyl-4-[(1Z)-2-methylbuta-1,3-dienyl]pyrazol-1-yl] thiohypofluorite (PubChem CID 166718799) has the molecular formula C11H13FN2S
and a molecular weight of 224.30 g/mol. Its IUPAC name is [5-ethenyl-3-methyl-4-[(1Z)-2-methylbuta-1,3-dienyl]pyrazol-1-yl] thiohypofluorite.
Molecular Properties
| Compound Name | [5-ethenyl-3-methyl-4-[(1Z)-2-methylbuta-1,3-dienyl]pyrazol-1-yl] thiohypofluorite |
| PubChem CID | 166718799 |
| Molecular Formula | C11H13FN2S |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | [5-ethenyl-3-methyl-4-[(1Z)-2-methylbuta-1,3-dienyl]pyrazol-1-yl] thiohypofluorite |
| SMILES | C=C/C(C)=C\c1c(C)nn(SF)c1C=C |
| InChI | InChI=1S/C11H13FN2S/c1-5-8(3)7-10-9(4)13-14(15-12)11(10)6-2/h5-7H,1-2H2,3-4H3/b8-7- |
| InChIKey | ANBKJPFEDDWSKW-FPLPWBNLSA-N |
| XLogP | 3.80 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [5-ethenyl-3-methyl-4-[(1Z)-2-methylbuta-1,3-dienyl]pyrazol-1-yl] thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-ethenyl-3-methyl-4-[(1Z)-2-methylbuta-1,3-dienyl]pyrazol-1-yl] thiohypofluorite?
The IUPAC name of [5-ethenyl-3-methyl-4-[(1Z)-2-methylbuta-1,3-dienyl]pyrazol-1-yl] thiohypofluorite (CID 166718799) is [5-ethenyl-3-methyl-4-[(1Z)-2-methylbuta-1,3-dienyl]pyrazol-1-yl] thiohypofluorite.
What is the SMILES notation for [5-ethenyl-3-methyl-4-[(1Z)-2-methylbuta-1,3-dienyl]pyrazol-1-yl] thiohypofluorite?
The canonical SMILES for [5-ethenyl-3-methyl-4-[(1Z)-2-methylbuta-1,3-dienyl]pyrazol-1-yl] thiohypofluorite is C=C/C(C)=C\c1c(C)nn(SF)c1C=C.
What is the InChIKey of [5-ethenyl-3-methyl-4-[(1Z)-2-methylbuta-1,3-dienyl]pyrazol-1-yl] thiohypofluorite?
The InChIKey is ANBKJPFEDDWSKW-FPLPWBNLSA-N. The full InChI is InChI=1S/C11H13FN2S/c1-5-8(3)7-10-9(4)13-14(15-12)11(10)6-2/h5-7H,1-2H2,3-4H3/b8-7-.
What are the key properties of [5-ethenyl-3-methyl-4-[(1Z)-2-methylbuta-1,3-dienyl]pyrazol-1-yl] thiohypofluorite?
[5-ethenyl-3-methyl-4-[(1Z)-2-methylbuta-1,3-dienyl]pyrazol-1-yl] thiohypofluorite has a molecular weight of 224.30 g/mol, XLogP of 3.80, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-ethenyl-3-methyl-4-[(1Z)-2-methylbuta-1,3-dienyl]pyrazol-1-yl] thiohypofluorite is sourced from PubChem (CID 166718799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).