C48H35N3 — CID 166718852
8-[2-[(1Z)-buta-1,3-dienyl]-3-methyl-1-(4-phenylphenyl)indol-7-yl]-5-(4-phenylphenyl)pyrido[3,2-b]indole (PubChem CID 166718852) has the molecular formula C48H35N3 and a molecular weight of 653.83 g/mol. Its IUPAC name is 8-[2-[(1Z)-buta-1,3-dienyl]-3-methyl-1-(4-phenylphenyl)indol-7-yl]-5-(4-phenylphenyl)pyrido[3,2-b]indole.
| Compound Name | 8-[2-[(1Z)-buta-1,3-dienyl]-3-methyl-1-(4-phenylphenyl)indol-7-yl]-5-(4-phenylphenyl)pyrido[3,2-b]indole |
|---|---|
| PubChem CID | 166718852 |
| Molecular Formula | C48H35N3 |
| Molecular Weight | 653.83 g/mol |
| Exact Mass | 653.28 |
| IUPAC Name | 8-[2-[(1Z)-buta-1,3-dienyl]-3-methyl-1-(4-phenylphenyl)indol-7-yl]-5-(4-phenylphenyl)pyrido[3,2-b]indole |
| SMILES | C=C/C=C\c1c(C)c2cccc(-c3ccc4c(c3)c3ncccc3n4-c3ccc(-c4ccccc4)cc3)c2n1-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C48H35N3/c1-3-4-19-44-33(2)41-17-11-18-42(48(41)51(44)40-28-23-37(24-29-40)35-15-9-6-10-16-35)38-25-30-45-43(32-38)47-46(20-12-31-49-47)50(45)39-26-21-36(22-27-39)34-13-7-5-8-14-34/h3-32H,1H2,2H3/b19-4- |
| InChIKey | XABVAPAXOOBYQU-PVOVUMCXSA-N |
| XLogP | 12.63 |
| TPSA | 22.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.83 |
| LogP ≤ 5 | 12.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|