C18H27N3 — CID 166718902
(1E)-2,3-dimethyl-N-[[6-(3-methylpiperidin-1-yl)-3-pyridinyl]methyl]buta-1,3-dien-1-amine (PubChem CID 166718902) has the molecular formula C18H27N3 and a molecular weight of 285.44 g/mol. Its IUPAC name is (1E)-2,3-dimethyl-N-[[6-(3-methylpiperidin-1-yl)-3-pyridinyl]methyl]buta-1,3-dien-1-amine.
| Compound Name | (1E)-2,3-dimethyl-N-[[6-(3-methylpiperidin-1-yl)-3-pyridinyl]methyl]buta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 166718902 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | (1E)-2,3-dimethyl-N-[[6-(3-methylpiperidin-1-yl)-3-pyridinyl]methyl]buta-1,3-dien-1-amine |
| SMILES | C=C(C)/C(C)=C/NCc1ccc(N2CCCC(C)C2)nc1 |
| InChI | InChI=1S/C18H27N3/c1-14(2)16(4)10-19-11-17-7-8-18(20-12-17)21-9-5-6-15(3)13-21/h7-8,10,12,15,19H,1,5-6,9,11,13H2,2-4H3/b16-10+ |
| InChIKey | PBKGGGRDVOPZOH-MHWRWJLKSA-N |
| XLogP | 3.89 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|