C12H18FNO — CID 166718975
7-(3-fluoropropyl)-1,2,3,4,6,7-hexahydroisoquinolin-6-ol (PubChem CID 166718975) has the molecular formula C12H18FNO and a molecular weight of 211.28 g/mol. Its IUPAC name is 7-(3-fluoropropyl)-1,2,3,4,6,7-hexahydroisoquinolin-6-ol.
| Compound Name | 7-(3-fluoropropyl)-1,2,3,4,6,7-hexahydroisoquinolin-6-ol |
|---|---|
| PubChem CID | 166718975 |
| Molecular Formula | C12H18FNO |
| Molecular Weight | 211.28 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 7-(3-fluoropropyl)-1,2,3,4,6,7-hexahydroisoquinolin-6-ol |
| SMILES | OC1C=C2CCNCC2=CC1CCCF |
| InChI | InChI=1S/C12H18FNO/c13-4-1-2-10-6-11-8-14-5-3-9(11)7-12(10)15/h6-7,10,12,14-15H,1-5,8H2 |
| InChIKey | CPSZQMHLYLCKMC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |