C14H17N3O2S — CID 166719157
1-N-cyclohexa-1,5-dien-1-yl-1-N'-(ethenylcarbamothioyl)cyclopropane-1,1-dicarboxamide (PubChem CID 166719157) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is 1-N-cyclohexa-1,5-dien-1-yl-1-N'-(ethenylcarbamothioyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-cyclohexa-1,5-dien-1-yl-1-N'-(ethenylcarbamothioyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 166719157 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 1-N-cyclohexa-1,5-dien-1-yl-1-N'-(ethenylcarbamothioyl)cyclopropane-1,1-dicarboxamide |
| SMILES | C=CNC(=S)NC(=O)C1(C(=O)NC2=CCCC=C2)CC1 |
| InChI | InChI=1S/C14H17N3O2S/c1-2-15-13(20)17-12(19)14(8-9-14)11(18)16-10-6-4-3-5-7-10/h2,4,6-7H,1,3,5,8-9H2,(H,16,18)(H2,15,17,19,20) |
| InChIKey | WSOSERQHMBXEPF-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|