C13H14N4O2S — CID 16671920
3-(12-ethyl-9-oxo-3-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),4,7,11-tetraen-10-yl)propanamide (PubChem CID 16671920) has the molecular formula C13H14N4O2S and a molecular weight of 290.35 g/mol. Its IUPAC name is 3-(12-ethyl-9-oxo-3-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),4,7,11-tetraen-10-yl)propanamide.
| Compound Name | 3-(12-ethyl-9-oxo-3-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),4,7,11-tetraen-10-yl)propanamide |
|---|---|
| PubChem CID | 16671920 |
| Molecular Formula | C13H14N4O2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 3-(12-ethyl-9-oxo-3-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),4,7,11-tetraen-10-yl)propanamide |
| SMILES | CCc1nn(CCC(N)=O)c(=O)c2cc3ccsc3n12 |
| InChI | InChI=1S/C13H14N4O2S/c1-2-11-15-16(5-3-10(14)18)12(19)9-7-8-4-6-20-13(8)17(9)11/h4,6-7H,2-3,5H2,1H3,(H2,14,18) |
| InChIKey | ZGRUOXXYNSHRLX-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 82.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |