C17H16ClFN2O2 — CID 166720300
5-[[(3-chlorobenzoyl)-methylamino]methyl]-2-fluoro-N-methylbenzamide (PubChem CID 166720300) has the molecular formula C17H16ClFN2O2 and a molecular weight of 334.78 g/mol. Its IUPAC name is 5-[[(3-chlorobenzoyl)-methylamino]methyl]-2-fluoro-N-methylbenzamide.
| Compound Name | 5-[[(3-chlorobenzoyl)-methylamino]methyl]-2-fluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 166720300 |
| Molecular Formula | C17H16ClFN2O2 |
| Molecular Weight | 334.78 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 5-[[(3-chlorobenzoyl)-methylamino]methyl]-2-fluoro-N-methylbenzamide |
| SMILES | CNC(=O)c1cc(CN(C)C(=O)c2cccc(Cl)c2)ccc1F |
| InChI | InChI=1S/C17H16ClFN2O2/c1-20-16(22)14-8-11(6-7-15(14)19)10-21(2)17(23)12-4-3-5-13(18)9-12/h3-9H,10H2,1-2H3,(H,20,22) |
| InChIKey | JVAGJSOMULNKLS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.78 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |