C22H25Cl2N3O4S — CID 166720722
ethyl 2-[2-chloro-4-[4-(6-chloro-2-pyridinyl)-2,3-dimethylpiperazine-1-carbonyl]phenyl]sulfinylacetate (PubChem CID 166720722) has the molecular formula C22H25Cl2N3O4S and a molecular weight of 498.43 g/mol. Its IUPAC name is ethyl 2-[2-chloro-4-[4-(6-chloro-2-pyridinyl)-2,3-dimethylpiperazine-1-carbonyl]phenyl]sulfinylacetate.
| Compound Name | ethyl 2-[2-chloro-4-[4-(6-chloro-2-pyridinyl)-2,3-dimethylpiperazine-1-carbonyl]phenyl]sulfinylacetate |
|---|---|
| PubChem CID | 166720722 |
| Molecular Formula | C22H25Cl2N3O4S |
| Molecular Weight | 498.43 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | ethyl 2-[2-chloro-4-[4-(6-chloro-2-pyridinyl)-2,3-dimethylpiperazine-1-carbonyl]phenyl]sulfinylacetate |
| SMILES | CCOC(=O)CS(=O)c1ccc(C(=O)N2CCN(c3cccc(Cl)n3)C(C)C2C)cc1Cl |
| InChI | InChI=1S/C22H25Cl2N3O4S/c1-4-31-21(28)13-32(30)18-9-8-16(12-17(18)23)22(29)27-11-10-26(14(2)15(27)3)20-7-5-6-19(24)25-20/h5-9,12,14-15H,4,10-11,13H2,1-3H3 |
| InChIKey | WPKGFVCMLMHAIO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|