C13H13IN4O4 — CID 166720894
5-iodo-2-[2-[(3-methoxyphenyl)methylamino]-2-oxoethyl]-1,2,4-triazole-3-carboxylic acid (PubChem CID 166720894) has the molecular formula C13H13IN4O4 and a molecular weight of 416.18 g/mol. Its IUPAC name is 5-iodo-2-[2-[(3-methoxyphenyl)methylamino]-2-oxoethyl]-1,2,4-triazole-3-carboxylic acid.
| Compound Name | 5-iodo-2-[2-[(3-methoxyphenyl)methylamino]-2-oxoethyl]-1,2,4-triazole-3-carboxylic acid |
|---|---|
| PubChem CID | 166720894 |
| Molecular Formula | C13H13IN4O4 |
| Molecular Weight | 416.18 g/mol |
| Exact Mass | 416.00 |
| IUPAC Name | 5-iodo-2-[2-[(3-methoxyphenyl)methylamino]-2-oxoethyl]-1,2,4-triazole-3-carboxylic acid |
| SMILES | COc1cccc(CNC(=O)Cn2nc(I)nc2C(=O)O)c1 |
| InChI | InChI=1S/C13H13IN4O4/c1-22-9-4-2-3-8(5-9)6-15-10(19)7-18-11(12(20)21)16-13(14)17-18/h2-5H,6-7H2,1H3,(H,15,19)(H,20,21) |
| InChIKey | WSVPDEKRBFGIGL-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.18 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|