C19H22ClNO3 — CID 166721233
[3-[4-(chloromethyl)-3-methylphenoxy]-3-phenylpropyl] N-methylcarbamate (PubChem CID 166721233) has the molecular formula C19H22ClNO3 and a molecular weight of 347.84 g/mol. Its IUPAC name is [3-[4-(chloromethyl)-3-methylphenoxy]-3-phenylpropyl] N-methylcarbamate.
| Compound Name | [3-[4-(chloromethyl)-3-methylphenoxy]-3-phenylpropyl] N-methylcarbamate |
|---|---|
| PubChem CID | 166721233 |
| Molecular Formula | C19H22ClNO3 |
| Molecular Weight | 347.84 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | [3-[4-(chloromethyl)-3-methylphenoxy]-3-phenylpropyl] N-methylcarbamate |
| SMILES | CNC(=O)OCCC(Oc1ccc(CCl)c(C)c1)c1ccccc1 |
| InChI | InChI=1S/C19H22ClNO3/c1-14-12-17(9-8-16(14)13-20)24-18(10-11-23-19(22)21-2)15-6-4-3-5-7-15/h3-9,12,18H,10-11,13H2,1-2H3,(H,21,22) |
| InChIKey | WCRGTQUMBAQGEO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.84 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|