(3R)-pyrrolidine-3-carboxamide;2,2,2-trifluoroacetic acid

C7H11F3N2O3 — CID 166721313

IUPAC(3R)-pyrrolidine-3-carboxamide;2,2,2-trifluoroacetic acid
SMILESNC(=O)[C@@H]1CCNC1.O=C(O)C(F)(F)F
InChIInChI=1S/C5H10N2O.C2HF3O2/c6-5(8)4-1-2-7-3-4;3-2(4,5)1(6)7/h4,7H,1-3H2,(H2,6,8);(H,6,7)/t4-;/m1./s1
InChIKeyNIIQPQLUVJAJNN-PGMHMLKASA-N
MW228.17 g/mol
LogP-0.29
Rot. Bonds1

About (3R)-pyrrolidine-3-carboxamide;2,2,2-trifluoroacetic acid

(3R)-pyrrolidine-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 166721313) has the molecular formula C7H11F3N2O3 and a molecular weight of 228.17 g/mol. Its IUPAC name is (3R)-pyrrolidine-3-carboxamide;2,2,2-trifluoroacetic acid.

Molecular Properties

Compound Name(3R)-pyrrolidine-3-carboxamide;2,2,2-trifluoroacetic acid
PubChem CID166721313
Molecular FormulaC7H11F3N2O3
Molecular Weight228.17 g/mol
Exact Mass228.07
IUPAC Name(3R)-pyrrolidine-3-carboxamide;2,2,2-trifluoroacetic acid
SMILESNC(=O)[C@@H]1CCNC1.O=C(O)C(F)(F)F
InChIInChI=1S/C5H10N2O.C2HF3O2/c6-5(8)4-1-2-7-3-4;3-2(4,5)1(6)7/h4,7H,1-3H2,(H2,6,8);(H,6,7)/t4-;/m1./s1
InChIKeyNIIQPQLUVJAJNN-PGMHMLKASA-N
XLogP-0.29
TPSA92.42 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.17
LogP ≤ 5-0.29
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze (3R)-pyrrolidine-3-carboxamide;2,2,2-trifluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3R)-pyrrolidine-3-carboxamide;2,2,2-trifluoroacetic acid?
The IUPAC name of (3R)-pyrrolidine-3-carboxamide;2,2,2-trifluoroacetic acid (CID 166721313) is (3R)-pyrrolidine-3-carboxamide;2,2,2-trifluoroacetic acid.
What is the SMILES notation for (3R)-pyrrolidine-3-carboxamide;2,2,2-trifluoroacetic acid?
The canonical SMILES for (3R)-pyrrolidine-3-carboxamide;2,2,2-trifluoroacetic acid is NC(=O)[C@@H]1CCNC1.O=C(O)C(F)(F)F.
What is the InChIKey of (3R)-pyrrolidine-3-carboxamide;2,2,2-trifluoroacetic acid?
The InChIKey is NIIQPQLUVJAJNN-PGMHMLKASA-N. The full InChI is InChI=1S/C5H10N2O.C2HF3O2/c6-5(8)4-1-2-7-3-4;3-2(4,5)1(6)7/h4,7H,1-3H2,(H2,6,8);(H,6,7)/t4-;/m1./s1.
What are the key properties of (3R)-pyrrolidine-3-carboxamide;2,2,2-trifluoroacetic acid?
(3R)-pyrrolidine-3-carboxamide;2,2,2-trifluoroacetic acid has a molecular weight of 228.17 g/mol, XLogP of -0.29, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-pyrrolidine-3-carboxamide;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 166721313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).