C28H21F4N3O7 — CID 166722111
3-[[2-(4-benzyl-2,3-dioxoquinoxalin-1-yl)acetyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid (PubChem CID 166722111) has the molecular formula C28H21F4N3O7 and a molecular weight of 587.48 g/mol. Its IUPAC name is 3-[[2-(4-benzyl-2,3-dioxoquinoxalin-1-yl)acetyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid.
| Compound Name | 3-[[2-(4-benzyl-2,3-dioxoquinoxalin-1-yl)acetyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
|---|---|
| PubChem CID | 166722111 |
| Molecular Formula | C28H21F4N3O7 |
| Molecular Weight | 587.48 g/mol |
| Exact Mass | 587.13 |
| IUPAC Name | 3-[[2-(4-benzyl-2,3-dioxoquinoxalin-1-yl)acetyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
| SMILES | O=C(O)CC(NC(=O)Cn1c(=O)c(=O)n(Cc2ccccc2)c2ccccc21)C(=O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C28H21F4N3O7/c29-16-10-17(30)25(32)26(24(16)31)42-14-21(36)18(11-23(38)39)33-22(37)13-35-20-9-5-4-8-19(20)34(27(40)28(35)41)12-15-6-2-1-3-7-15/h1-10,18H,11-14H2,(H,33,37)(H,38,39) |
| InChIKey | FQUPIYVOSOVLPU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 136.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.48 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|