C20H25N5O3 — CID 16672214
4-[3-(3-cyclopropyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-3-oxopropyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 16672214) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is 4-[3-(3-cyclopropyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-3-oxopropyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | 4-[3-(3-cyclopropyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-3-oxopropyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 16672214 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 4-[3-(3-cyclopropyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-3-oxopropyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | O=C(CCN1C(=O)C2C3CCC(C3)C2C1=O)N1CCn2c(nnc2C2CC2)C1 |
| InChI | InChI=1S/C20H25N5O3/c26-15(23-7-8-24-14(10-23)21-22-18(24)11-1-2-11)5-6-25-19(27)16-12-3-4-13(9-12)17(16)20(25)28/h11-13,16-17H,1-10H2 |
| InChIKey | RSENDLJUDZWZDY-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 88.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|