About (4-bromo-2,6-dimethoxyphenyl)methyl-triphenylphosphanium chloride
(4-bromo-2,6-dimethoxyphenyl)methyl-triphenylphosphanium chloride (PubChem CID 166722612) has the molecular formula C27H25BrClO2P
and a molecular weight of 527.83 g/mol. Its IUPAC name is (4-bromo-2,6-dimethoxyphenyl)methyl-triphenylphosphanium chloride.
Molecular Properties
| Compound Name | (4-bromo-2,6-dimethoxyphenyl)methyl-triphenylphosphanium chloride |
| PubChem CID | 166722612 |
| Molecular Formula | C27H25BrClO2P |
| Molecular Weight | 527.83 g/mol |
| Exact Mass | 526.05 |
| IUPAC Name | (4-bromo-2,6-dimethoxyphenyl)methyl-triphenylphosphanium chloride |
| SMILES | COc1cc(Br)cc(OC)c1C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C27H25BrO2P.ClH/c1-29-26-18-21(28)19-27(30-2)25(26)20-31(22-12-6-3-7-13-22,23-14-8-4-9-15-23)24-16-10-5-11-17-24;/h3-19H,20H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | HLJBAJHISMCCRE-UHFFFAOYSA-M |
| XLogP | 2.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 527.83 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (4-bromo-2,6-dimethoxyphenyl)methyl-triphenylphosphanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-2,6-dimethoxyphenyl)methyl-triphenylphosphanium chloride?
The IUPAC name of (4-bromo-2,6-dimethoxyphenyl)methyl-triphenylphosphanium chloride (CID 166722612) is (4-bromo-2,6-dimethoxyphenyl)methyl-triphenylphosphanium chloride.
What is the SMILES notation for (4-bromo-2,6-dimethoxyphenyl)methyl-triphenylphosphanium chloride?
The canonical SMILES for (4-bromo-2,6-dimethoxyphenyl)methyl-triphenylphosphanium chloride is COc1cc(Br)cc(OC)c1C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Cl-].
What is the InChIKey of (4-bromo-2,6-dimethoxyphenyl)methyl-triphenylphosphanium chloride?
The InChIKey is HLJBAJHISMCCRE-UHFFFAOYSA-M. The full InChI is InChI=1S/C27H25BrO2P.ClH/c1-29-26-18-21(28)19-27(30-2)25(26)20-31(22-12-6-3-7-13-22,23-14-8-4-9-15-23)24-16-10-5-11-17-24;/h3-19H,20H2,1-2H3;1H/q+1;/p-1.
What are the key properties of (4-bromo-2,6-dimethoxyphenyl)methyl-triphenylphosphanium chloride?
(4-bromo-2,6-dimethoxyphenyl)methyl-triphenylphosphanium chloride has a molecular weight of 527.83 g/mol, XLogP of 2.96, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-2,6-dimethoxyphenyl)methyl-triphenylphosphanium chloride is sourced from PubChem (CID 166722612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).