C13H25BrN2O2 — CID 166722696
4-bromo-N-(2,2,6,6-tetramethylpiperidin-1-yl)oxybutanamide (PubChem CID 166722696) has the molecular formula C13H25BrN2O2 and a molecular weight of 321.26 g/mol. Its IUPAC name is 4-bromo-N-(2,2,6,6-tetramethylpiperidin-1-yl)oxybutanamide.
| Compound Name | 4-bromo-N-(2,2,6,6-tetramethylpiperidin-1-yl)oxybutanamide |
|---|---|
| PubChem CID | 166722696 |
| Molecular Formula | C13H25BrN2O2 |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 4-bromo-N-(2,2,6,6-tetramethylpiperidin-1-yl)oxybutanamide |
| SMILES | CC1(C)CCCC(C)(C)N1ONC(=O)CCCBr |
| InChI | InChI=1S/C13H25BrN2O2/c1-12(2)8-6-9-13(3,4)16(12)18-15-11(17)7-5-10-14/h5-10H2,1-4H3,(H,15,17) |
| InChIKey | QTJVJKKBAXVLNS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|