C14H19N — CID 166722722
(2S)-2-(cyclodecapentaenyl)-N-methylpropan-1-amine (PubChem CID 166722722) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is (2S)-2-(cyclodecapentaenyl)-N-methylpropan-1-amine.
| Compound Name | (2S)-2-(cyclodecapentaenyl)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 166722722 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | (2S)-2-(cyclodecapentaenyl)-N-methylpropan-1-amine |
| SMILES | CNC[C@@H](C)c1ccccccccc1 |
| InChI | InChI=1S/C14H19N/c1-13(12-15-2)14-10-8-6-4-3-5-7-9-11-14/h3-11,13,15H,12H2,1-2H3/b4-3-,5-3-,6-4-,7-5+,8-6+,9-7+,10-8+,11-9-,14-10+,14-11+/t13-/m1/s1 |
| InChIKey | FRRGFVPOFCALCT-FPUTYMHBSA-N |
| XLogP | 3.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |