About 2,7-dimethyl-6,7-dihydroquinoxaline
2,7-dimethyl-6,7-dihydroquinoxaline (PubChem CID 166723887) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 2,7-dimethyl-6,7-dihydroquinoxaline.
Molecular Properties
| Compound Name | 2,7-dimethyl-6,7-dihydroquinoxaline |
| PubChem CID | 166723887 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 2,7-dimethyl-6,7-dihydroquinoxaline |
| SMILES | Cc1cnc2c(n1)=CC(C)CC=2 |
| InChI | InChI=1S/C10H12N2/c1-7-3-4-9-10(5-7)12-8(2)6-11-9/h4-7H,3H2,1-2H3 |
| InChIKey | UGFNJBQVEFKLOX-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,7-dimethyl-6,7-dihydroquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dimethyl-6,7-dihydroquinoxaline?
The IUPAC name of 2,7-dimethyl-6,7-dihydroquinoxaline (CID 166723887) is 2,7-dimethyl-6,7-dihydroquinoxaline.
What is the SMILES notation for 2,7-dimethyl-6,7-dihydroquinoxaline?
The canonical SMILES for 2,7-dimethyl-6,7-dihydroquinoxaline is Cc1cnc2c(n1)=CC(C)CC=2.
What is the InChIKey of 2,7-dimethyl-6,7-dihydroquinoxaline?
The InChIKey is UGFNJBQVEFKLOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c1-7-3-4-9-10(5-7)12-8(2)6-11-9/h4-7H,3H2,1-2H3.
What are the key properties of 2,7-dimethyl-6,7-dihydroquinoxaline?
2,7-dimethyl-6,7-dihydroquinoxaline has a molecular weight of 160.22 g/mol, XLogP of 0.39, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dimethyl-6,7-dihydroquinoxaline is sourced from PubChem (CID 166723887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).