C35H45N5O2 — CID 166724132
[2-[1-[[1-(4-cyanophenyl)azetidin-3-yl]methyl]piperidin-4-yl]-1-(2-ethylimidazol-1-yl)-2-phenylheptan-4-yl] formate (PubChem CID 166724132) has the molecular formula C35H45N5O2 and a molecular weight of 567.78 g/mol. Its IUPAC name is [2-[1-[[1-(4-cyanophenyl)azetidin-3-yl]methyl]piperidin-4-yl]-1-(2-ethylimidazol-1-yl)-2-phenylheptan-4-yl] formate.
| Compound Name | [2-[1-[[1-(4-cyanophenyl)azetidin-3-yl]methyl]piperidin-4-yl]-1-(2-ethylimidazol-1-yl)-2-phenylheptan-4-yl] formate |
|---|---|
| PubChem CID | 166724132 |
| Molecular Formula | C35H45N5O2 |
| Molecular Weight | 567.78 g/mol |
| Exact Mass | 567.36 |
| IUPAC Name | [2-[1-[[1-(4-cyanophenyl)azetidin-3-yl]methyl]piperidin-4-yl]-1-(2-ethylimidazol-1-yl)-2-phenylheptan-4-yl] formate |
| SMILES | CCCC(CC(Cn1ccnc1CC)(c1ccccc1)C1CCN(CC2CN(c3ccc(C#N)cc3)C2)CC1)OC=O |
| InChI | InChI=1S/C35H45N5O2/c1-3-8-33(42-27-41)21-35(30-9-6-5-7-10-30,26-39-20-17-37-34(39)4-2)31-15-18-38(19-16-31)23-29-24-40(25-29)32-13-11-28(22-36)12-14-32/h5-7,9-14,17,20,27,29,31,33H,3-4,8,15-16,18-19,21,23-26H2,1-2H3 |
| InChIKey | CGJKNICYGQPCFH-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 74.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.78 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|