C36H50N6OS — CID 166724205
N-[4-[3-[[4-(4-cyclopentyl-2-ethyl-1,3-dihydroisoquinolin-4-yl)piperidin-1-yl]methyl]azetidin-1-yl]phenoxy]sulfanyl-N,1-dimethylpyrazol-4-amine (PubChem CID 166724205) has the molecular formula C36H50N6OS and a molecular weight of 614.90 g/mol. Its IUPAC name is N-[4-[3-[[4-(4-cyclopentyl-2-ethyl-1,3-dihydroisoquinolin-4-yl)piperidin-1-yl]methyl]azetidin-1-yl]phenoxy]sulfanyl-N,1-dimethylpyrazol-4-amine.
| Compound Name | N-[4-[3-[[4-(4-cyclopentyl-2-ethyl-1,3-dihydroisoquinolin-4-yl)piperidin-1-yl]methyl]azetidin-1-yl]phenoxy]sulfanyl-N,1-dimethylpyrazol-4-amine |
|---|---|
| PubChem CID | 166724205 |
| Molecular Formula | C36H50N6OS |
| Molecular Weight | 614.90 g/mol |
| Exact Mass | 614.38 |
| IUPAC Name | N-[4-[3-[[4-(4-cyclopentyl-2-ethyl-1,3-dihydroisoquinolin-4-yl)piperidin-1-yl]methyl]azetidin-1-yl]phenoxy]sulfanyl-N,1-dimethylpyrazol-4-amine |
| SMILES | CCN1Cc2ccccc2C(C2CCCC2)(C2CCN(CC3CN(c4ccc(OSN(C)c5cnn(C)c5)cc4)C3)CC2)C1 |
| InChI | InChI=1S/C36H50N6OS/c1-4-40-25-29-9-5-8-12-35(29)36(27-40,30-10-6-7-11-30)31-17-19-41(20-18-31)22-28-23-42(24-28)32-13-15-34(16-14-32)43-44-39(3)33-21-37-38(2)26-33/h5,8-9,12-16,21,26,28,30-31H,4,6-7,10-11,17-20,22-25,27H2,1-3H3 |
| InChIKey | BAHYZHBWHQGZMD-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 40.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.90 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|