About 2-(2-ethyl-4-hexyl-3,7-dihydro-1H-cyclohepta[c]pyridin-4-yl)-N-propylpentan-1-amine
2-(2-ethyl-4-hexyl-3,7-dihydro-1H-cyclohepta[c]pyridin-4-yl)-N-propylpentan-1-amine (PubChem CID 166724302) has the molecular formula C26H46N2
and a molecular weight of 386.67 g/mol. Its IUPAC name is 2-(2-ethyl-4-hexyl-3,7-dihydro-1H-cyclohepta[c]pyridin-4-yl)-N-propylpentan-1-amine.
Molecular Properties
| Compound Name | 2-(2-ethyl-4-hexyl-3,7-dihydro-1H-cyclohepta[c]pyridin-4-yl)-N-propylpentan-1-amine |
| PubChem CID | 166724302 |
| Molecular Formula | C26H46N2 |
| Molecular Weight | 386.67 g/mol |
| Exact Mass | 386.37 |
| IUPAC Name | 2-(2-ethyl-4-hexyl-3,7-dihydro-1H-cyclohepta[c]pyridin-4-yl)-N-propylpentan-1-amine |
| SMILES | CCCCCCC1(C(CCC)CNCCC)CN(CC)CC2=C1C=CCC=C2 |
| InChI | InChI=1S/C26H46N2/c1-5-9-10-14-18-26(24(15-6-2)20-27-19-7-3)22-28(8-4)21-23-16-12-11-13-17-25(23)26/h12-13,16-17,24,27H,5-11,14-15,18-22H2,1-4H3 |
| InChIKey | JEVCWYXCZAVRKX-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.67 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-ethyl-4-hexyl-3,7-dihydro-1H-cyclohepta[c]pyridin-4-yl)-N-propylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethyl-4-hexyl-3,7-dihydro-1H-cyclohepta[c]pyridin-4-yl)-N-propylpentan-1-amine?
The IUPAC name of 2-(2-ethyl-4-hexyl-3,7-dihydro-1H-cyclohepta[c]pyridin-4-yl)-N-propylpentan-1-amine (CID 166724302) is 2-(2-ethyl-4-hexyl-3,7-dihydro-1H-cyclohepta[c]pyridin-4-yl)-N-propylpentan-1-amine.
What is the SMILES notation for 2-(2-ethyl-4-hexyl-3,7-dihydro-1H-cyclohepta[c]pyridin-4-yl)-N-propylpentan-1-amine?
The canonical SMILES for 2-(2-ethyl-4-hexyl-3,7-dihydro-1H-cyclohepta[c]pyridin-4-yl)-N-propylpentan-1-amine is CCCCCCC1(C(CCC)CNCCC)CN(CC)CC2=C1C=CCC=C2.
What is the InChIKey of 2-(2-ethyl-4-hexyl-3,7-dihydro-1H-cyclohepta[c]pyridin-4-yl)-N-propylpentan-1-amine?
The InChIKey is JEVCWYXCZAVRKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H46N2/c1-5-9-10-14-18-26(24(15-6-2)20-27-19-7-3)22-28(8-4)21-23-16-12-11-13-17-25(23)26/h12-13,16-17,24,27H,5-11,14-15,18-22H2,1-4H3.
What are the key properties of 2-(2-ethyl-4-hexyl-3,7-dihydro-1H-cyclohepta[c]pyridin-4-yl)-N-propylpentan-1-amine?
2-(2-ethyl-4-hexyl-3,7-dihydro-1H-cyclohepta[c]pyridin-4-yl)-N-propylpentan-1-amine has a molecular weight of 386.67 g/mol, XLogP of 6.51, 13 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethyl-4-hexyl-3,7-dihydro-1H-cyclohepta[c]pyridin-4-yl)-N-propylpentan-1-amine is sourced from PubChem (CID 166724302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).