C30H54N2 — CID 166724467
N-[(Z,3E)-2-cyclopentyl-3-ethylidene-2-nonan-4-yloct-4-enyl]-N'-ethyl-N-prop-1-en-2-ylmethanimidamide (PubChem CID 166724467) has the molecular formula C30H54N2 and a molecular weight of 442.78 g/mol. Its IUPAC name is N-[(Z,3E)-2-cyclopentyl-3-ethylidene-2-nonan-4-yloct-4-enyl]-N'-ethyl-N-prop-1-en-2-ylmethanimidamide.
| Compound Name | N-[(Z,3E)-2-cyclopentyl-3-ethylidene-2-nonan-4-yloct-4-enyl]-N'-ethyl-N-prop-1-en-2-ylmethanimidamide |
|---|---|
| PubChem CID | 166724467 |
| Molecular Formula | C30H54N2 |
| Molecular Weight | 442.78 g/mol |
| Exact Mass | 442.43 |
| IUPAC Name | N-[(Z,3E)-2-cyclopentyl-3-ethylidene-2-nonan-4-yloct-4-enyl]-N'-ethyl-N-prop-1-en-2-ylmethanimidamide |
| SMILES | C=C(C)N(/C=N/CC)CC(C(/C=C\CCC)=C/C)(C(CCC)CCCCC)C1CCCC1 |
| InChI | InChI=1S/C30H54N2/c1-8-13-15-20-27(11-4)30(29-22-17-18-23-29,24-32(26(6)7)25-31-12-5)28(19-10-3)21-16-14-9-2/h11,15,20,25,28-29H,6,8-10,12-14,16-19,21-24H2,1-5,7H3/b20-15-,27-11+,31-25+ |
| InChIKey | FQQHLRMDSGLTOD-JAZSZKCHSA-N |
| XLogP | 9.35 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.78 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|