C20H14O5 — CID 166724679
(3R)-3,6-dihydroxyspiro[2,3-dihydroxanthene-9,3'-2-benzofuran]-1'-one (PubChem CID 166724679) has the molecular formula C20H14O5 and a molecular weight of 334.33 g/mol. Its IUPAC name is (3R)-3,6-dihydroxyspiro[2,3-dihydroxanthene-9,3'-2-benzofuran]-1'-one.
| Compound Name | (3R)-3,6-dihydroxyspiro[2,3-dihydroxanthene-9,3'-2-benzofuran]-1'-one |
|---|---|
| PubChem CID | 166724679 |
| Molecular Formula | C20H14O5 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | (3R)-3,6-dihydroxyspiro[2,3-dihydroxanthene-9,3'-2-benzofuran]-1'-one |
| SMILES | O=C1OC2(C3=CC[C@@H](O)C=C3Oc3cc(O)ccc32)c2ccccc21 |
| InChI | InChI=1S/C20H14O5/c21-11-5-7-15-17(9-11)24-18-10-12(22)6-8-16(18)20(15)14-4-2-1-3-13(14)19(23)25-20/h1-5,7-10,12,21-22H,6H2/t12-,20?/m1/s1 |
| InChIKey | KXBUJFGEWNDYIP-ZRIYNBNISA-N |
| XLogP | 2.77 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |