About 2-prop-2-enoyloxyethyl (2E)-2-cyano-2-(5-hydroxy-4,7-diiodo-1,3-benzodithiol-2-ylidene)acetate
2-prop-2-enoyloxyethyl (2E)-2-cyano-2-(5-hydroxy-4,7-diiodo-1,3-benzodithiol-2-ylidene)acetate (PubChem CID 166724905) has the molecular formula C15H9I2NO5S2
and a molecular weight of 601.18 g/mol. Its IUPAC name is 2-prop-2-enoyloxyethyl (2E)-2-cyano-2-(5-hydroxy-4,7-diiodo-1,3-benzodithiol-2-ylidene)acetate.
Molecular Properties
| Compound Name | 2-prop-2-enoyloxyethyl (2E)-2-cyano-2-(5-hydroxy-4,7-diiodo-1,3-benzodithiol-2-ylidene)acetate |
| PubChem CID | 166724905 |
| Molecular Formula | C15H9I2NO5S2 |
| Molecular Weight | 601.18 g/mol |
| Exact Mass | 600.80 |
| IUPAC Name | 2-prop-2-enoyloxyethyl (2E)-2-cyano-2-(5-hydroxy-4,7-diiodo-1,3-benzodithiol-2-ylidene)acetate |
| SMILES | C=CC(=O)OCCOC(=O)/C(C#N)=C1\Sc2c(I)cc(O)c(I)c2S1 |
| InChI | InChI=1S/C15H9I2NO5S2/c1-2-10(20)22-3-4-23-14(21)7(6-18)15-24-12-8(16)5-9(19)11(17)13(12)25-15/h2,5,19H,1,3-4H2/b15-7+ |
| InChIKey | OMSCXXZOKZXQRM-VIZOYTHASA-N |
| XLogP | 3.81 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 601.18 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-enoyloxyethyl (2E)-2-cyano-2-(5-hydroxy-4,7-diiodo-1,3-benzodithiol-2-ylidene)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-enoyloxyethyl (2E)-2-cyano-2-(5-hydroxy-4,7-diiodo-1,3-benzodithiol-2-ylidene)acetate?
The IUPAC name of 2-prop-2-enoyloxyethyl (2E)-2-cyano-2-(5-hydroxy-4,7-diiodo-1,3-benzodithiol-2-ylidene)acetate (CID 166724905) is 2-prop-2-enoyloxyethyl (2E)-2-cyano-2-(5-hydroxy-4,7-diiodo-1,3-benzodithiol-2-ylidene)acetate.
What is the SMILES notation for 2-prop-2-enoyloxyethyl (2E)-2-cyano-2-(5-hydroxy-4,7-diiodo-1,3-benzodithiol-2-ylidene)acetate?
The canonical SMILES for 2-prop-2-enoyloxyethyl (2E)-2-cyano-2-(5-hydroxy-4,7-diiodo-1,3-benzodithiol-2-ylidene)acetate is C=CC(=O)OCCOC(=O)/C(C#N)=C1\Sc2c(I)cc(O)c(I)c2S1.
What is the InChIKey of 2-prop-2-enoyloxyethyl (2E)-2-cyano-2-(5-hydroxy-4,7-diiodo-1,3-benzodithiol-2-ylidene)acetate?
The InChIKey is OMSCXXZOKZXQRM-VIZOYTHASA-N. The full InChI is InChI=1S/C15H9I2NO5S2/c1-2-10(20)22-3-4-23-14(21)7(6-18)15-24-12-8(16)5-9(19)11(17)13(12)25-15/h2,5,19H,1,3-4H2/b15-7+.
What are the key properties of 2-prop-2-enoyloxyethyl (2E)-2-cyano-2-(5-hydroxy-4,7-diiodo-1,3-benzodithiol-2-ylidene)acetate?
2-prop-2-enoyloxyethyl (2E)-2-cyano-2-(5-hydroxy-4,7-diiodo-1,3-benzodithiol-2-ylidene)acetate has a molecular weight of 601.18 g/mol, XLogP of 3.81, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-enoyloxyethyl (2E)-2-cyano-2-(5-hydroxy-4,7-diiodo-1,3-benzodithiol-2-ylidene)acetate is sourced from PubChem (CID 166724905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).