C26H36N4O4 — CID 166725592
1-[2-(2-ethoxyethylamino)ethylamino]-5-[2-[ethyl(2-hydroxyethyl)amino]ethylamino]anthracene-9,10-dione (PubChem CID 166725592) has the molecular formula C26H36N4O4 and a molecular weight of 468.60 g/mol. Its IUPAC name is 1-[2-(2-ethoxyethylamino)ethylamino]-5-[2-[ethyl(2-hydroxyethyl)amino]ethylamino]anthracene-9,10-dione.
| Compound Name | 1-[2-(2-ethoxyethylamino)ethylamino]-5-[2-[ethyl(2-hydroxyethyl)amino]ethylamino]anthracene-9,10-dione |
|---|---|
| PubChem CID | 166725592 |
| Molecular Formula | C26H36N4O4 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | 1-[2-(2-ethoxyethylamino)ethylamino]-5-[2-[ethyl(2-hydroxyethyl)amino]ethylamino]anthracene-9,10-dione |
| SMILES | CCOCCNCCNc1cccc2c1C(=O)c1cccc(NCCN(CC)CCO)c1C2=O |
| InChI | InChI=1S/C26H36N4O4/c1-3-30(16-17-31)15-13-29-22-10-6-8-20-24(22)26(33)19-7-5-9-21(23(19)25(20)32)28-12-11-27-14-18-34-4-2/h5-10,27-29,31H,3-4,11-18H2,1-2H3 |
| InChIKey | XKTJECVTOMPGPH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|