C25H21F2N7O2S — CID 166725731
5-[[[5-fluoro-2-[1-[(2-fluorophenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazol-3-yl]pyrimidin-4-yl]amino]methyl]-2-(methylsulfanylamino)phenol (PubChem CID 166725731) has the molecular formula C25H21F2N7O2S and a molecular weight of 521.55 g/mol. Its IUPAC name is 5-[[[5-fluoro-2-[1-[(2-fluorophenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazol-3-yl]pyrimidin-4-yl]amino]methyl]-2-(methylsulfanylamino)phenol.
| Compound Name | 5-[[[5-fluoro-2-[1-[(2-fluorophenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazol-3-yl]pyrimidin-4-yl]amino]methyl]-2-(methylsulfanylamino)phenol |
|---|---|
| PubChem CID | 166725731 |
| Molecular Formula | C25H21F2N7O2S |
| Molecular Weight | 521.55 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | 5-[[[5-fluoro-2-[1-[(2-fluorophenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazol-3-yl]pyrimidin-4-yl]amino]methyl]-2-(methylsulfanylamino)phenol |
| SMILES | CSNc1ccc(CNc2nc(-c3cc(-c4ccon4)n(Cc4ccccc4F)n3)ncc2F)cc1O |
| InChI | InChI=1S/C25H21F2N7O2S/c1-37-33-20-7-6-15(10-23(20)35)12-28-24-18(27)13-29-25(30-24)21-11-22(19-8-9-36-32-19)34(31-21)14-16-4-2-3-5-17(16)26/h2-11,13,33,35H,12,14H2,1H3,(H,28,29,30) |
| InChIKey | CEXJUFFQFQZNOC-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 113.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.55 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|