About N-ethyl-N-(propan-2-ylideneamino)cyclohepta-1,6-dien-1-amine
N-ethyl-N-(propan-2-ylideneamino)cyclohepta-1,6-dien-1-amine (PubChem CID 166726117) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is N-ethyl-N-(propan-2-ylideneamino)cyclohepta-1,6-dien-1-amine.
Molecular Properties
| Compound Name | N-ethyl-N-(propan-2-ylideneamino)cyclohepta-1,6-dien-1-amine |
| PubChem CID | 166726117 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | N-ethyl-N-(propan-2-ylideneamino)cyclohepta-1,6-dien-1-amine |
| SMILES | CCN(N=C(C)C)C1=CCCCC=C1 |
| InChI | InChI=1S/C12H20N2/c1-4-14(13-11(2)3)12-9-7-5-6-8-10-12/h7,9-10H,4-6,8H2,1-3H3 |
| InChIKey | NEDGTZPXFDGFKE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-(propan-2-ylideneamino)cyclohepta-1,6-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-(propan-2-ylideneamino)cyclohepta-1,6-dien-1-amine?
The IUPAC name of N-ethyl-N-(propan-2-ylideneamino)cyclohepta-1,6-dien-1-amine (CID 166726117) is N-ethyl-N-(propan-2-ylideneamino)cyclohepta-1,6-dien-1-amine.
What is the SMILES notation for N-ethyl-N-(propan-2-ylideneamino)cyclohepta-1,6-dien-1-amine?
The canonical SMILES for N-ethyl-N-(propan-2-ylideneamino)cyclohepta-1,6-dien-1-amine is CCN(N=C(C)C)C1=CCCCC=C1.
What is the InChIKey of N-ethyl-N-(propan-2-ylideneamino)cyclohepta-1,6-dien-1-amine?
The InChIKey is NEDGTZPXFDGFKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2/c1-4-14(13-11(2)3)12-9-7-5-6-8-10-12/h7,9-10H,4-6,8H2,1-3H3.
What are the key properties of N-ethyl-N-(propan-2-ylideneamino)cyclohepta-1,6-dien-1-amine?
N-ethyl-N-(propan-2-ylideneamino)cyclohepta-1,6-dien-1-amine has a molecular weight of 192.31 g/mol, XLogP of 3.33, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-(propan-2-ylideneamino)cyclohepta-1,6-dien-1-amine is sourced from PubChem (CID 166726117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).