About 3-ethyl-2,6-di(propan-2-yl)pyridine
3-ethyl-2,6-di(propan-2-yl)pyridine (PubChem CID 166726878) has the molecular formula C13H21N
and a molecular weight of 191.32 g/mol. Its IUPAC name is 3-ethyl-2,6-di(propan-2-yl)pyridine.
Molecular Properties
| Compound Name | 3-ethyl-2,6-di(propan-2-yl)pyridine |
| PubChem CID | 166726878 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 3-ethyl-2,6-di(propan-2-yl)pyridine |
| SMILES | CCc1ccc(C(C)C)nc1C(C)C |
| InChI | InChI=1S/C13H21N/c1-6-11-7-8-12(9(2)3)14-13(11)10(4)5/h7-10H,6H2,1-5H3 |
| InChIKey | VRGCXLGFXKOYBA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethyl-2,6-di(propan-2-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2,6-di(propan-2-yl)pyridine?
The IUPAC name of 3-ethyl-2,6-di(propan-2-yl)pyridine (CID 166726878) is 3-ethyl-2,6-di(propan-2-yl)pyridine.
What is the SMILES notation for 3-ethyl-2,6-di(propan-2-yl)pyridine?
The canonical SMILES for 3-ethyl-2,6-di(propan-2-yl)pyridine is CCc1ccc(C(C)C)nc1C(C)C.
What is the InChIKey of 3-ethyl-2,6-di(propan-2-yl)pyridine?
The InChIKey is VRGCXLGFXKOYBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N/c1-6-11-7-8-12(9(2)3)14-13(11)10(4)5/h7-10H,6H2,1-5H3.
What are the key properties of 3-ethyl-2,6-di(propan-2-yl)pyridine?
3-ethyl-2,6-di(propan-2-yl)pyridine has a molecular weight of 191.32 g/mol, XLogP of 3.89, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2,6-di(propan-2-yl)pyridine is sourced from PubChem (CID 166726878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).