C26H30F3N3O — CID 166726913
(1E,3E)-2-methyl-1-[2-(methylideneamino)-4-(trifluoromethyl)phenyl]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nona-1,3-dien-5-ol (PubChem CID 166726913) has the molecular formula C26H30F3N3O and a molecular weight of 457.54 g/mol. Its IUPAC name is (1E,3E)-2-methyl-1-[2-(methylideneamino)-4-(trifluoromethyl)phenyl]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nona-1,3-dien-5-ol.
| Compound Name | (1E,3E)-2-methyl-1-[2-(methylideneamino)-4-(trifluoromethyl)phenyl]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nona-1,3-dien-5-ol |
|---|---|
| PubChem CID | 166726913 |
| Molecular Formula | C26H30F3N3O |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | (1E,3E)-2-methyl-1-[2-(methylideneamino)-4-(trifluoromethyl)phenyl]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nona-1,3-dien-5-ol |
| SMILES | C=Nc1cc(C(F)(F)F)ccc1/C=C(C)/C=C/C(O)CCCCc1ccc2c(n1)NCCC2 |
| InChI | InChI=1S/C26H30F3N3O/c1-18(16-20-10-12-21(26(27,28)29)17-24(20)30-2)9-14-23(33)8-4-3-7-22-13-11-19-6-5-15-31-25(19)32-22/h9-14,16-17,23,33H,2-8,15H2,1H3,(H,31,32)/b14-9+,18-16+ |
| InChIKey | WYLJZOFQVOBUQM-QNVRJZFTSA-N |
| XLogP | 6.52 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|