C14H21N — CID 166727100
N,2-dimethyl-N-(1,2,2-trimethylcyclopropyl)aniline (PubChem CID 166727100) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is N,2-dimethyl-N-(1,2,2-trimethylcyclopropyl)aniline.
| Compound Name | N,2-dimethyl-N-(1,2,2-trimethylcyclopropyl)aniline |
|---|---|
| PubChem CID | 166727100 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | N,2-dimethyl-N-(1,2,2-trimethylcyclopropyl)aniline |
| SMILES | Cc1ccccc1N(C)C1(C)CC1(C)C |
| InChI | InChI=1S/C14H21N/c1-11-8-6-7-9-12(11)15(5)14(4)10-13(14,2)3/h6-9H,10H2,1-5H3 |
| InChIKey | ZTMLLFXMPXALGK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |