C23H31N3O2 — CID 166727421
6-[1-[(3R,4S)-4-[(2,6-dimethyl-4-pyridinyl)methyl]-3-methylpiperidin-1-yl]ethyl]-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine (PubChem CID 166727421) has the molecular formula C23H31N3O2 and a molecular weight of 381.52 g/mol. Its IUPAC name is 6-[1-[(3R,4S)-4-[(2,6-dimethyl-4-pyridinyl)methyl]-3-methylpiperidin-1-yl]ethyl]-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine.
| Compound Name | 6-[1-[(3R,4S)-4-[(2,6-dimethyl-4-pyridinyl)methyl]-3-methylpiperidin-1-yl]ethyl]-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine |
|---|---|
| PubChem CID | 166727421 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | 6-[1-[(3R,4S)-4-[(2,6-dimethyl-4-pyridinyl)methyl]-3-methylpiperidin-1-yl]ethyl]-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine |
| SMILES | Cc1cc(C[C@H]2CCN(C(C)c3ccc4c(n3)OCCO4)C[C@@H]2C)cc(C)n1 |
| InChI | InChI=1S/C23H31N3O2/c1-15-14-26(8-7-20(15)13-19-11-16(2)24-17(3)12-19)18(4)21-5-6-22-23(25-21)28-10-9-27-22/h5-6,11-12,15,18,20H,7-10,13-14H2,1-4H3/t15-,18?,20+/m0/s1 |
| InChIKey | YRWHKVYOBQLLOF-BEHPGTHXSA-N |
| XLogP | 4.13 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |