About 4-iodo-5-[3-(5-methyl-1,3-thiazol-2-yl)butyl]-3-propan-2-yl-1,2-oxazole
4-iodo-5-[3-(5-methyl-1,3-thiazol-2-yl)butyl]-3-propan-2-yl-1,2-oxazole (PubChem CID 166727457) has the molecular formula C14H19IN2OS
and a molecular weight of 390.29 g/mol. Its IUPAC name is 4-iodo-5-[3-(5-methyl-1,3-thiazol-2-yl)butyl]-3-propan-2-yl-1,2-oxazole.
Molecular Properties
| Compound Name | 4-iodo-5-[3-(5-methyl-1,3-thiazol-2-yl)butyl]-3-propan-2-yl-1,2-oxazole |
| PubChem CID | 166727457 |
| Molecular Formula | C14H19IN2OS |
| Molecular Weight | 390.29 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | 4-iodo-5-[3-(5-methyl-1,3-thiazol-2-yl)butyl]-3-propan-2-yl-1,2-oxazole |
| SMILES | Cc1cnc(C(C)CCc2onc(C(C)C)c2I)s1 |
| InChI | InChI=1S/C14H19IN2OS/c1-8(2)13-12(15)11(18-17-13)6-5-9(3)14-16-7-10(4)19-14/h7-9H,5-6H2,1-4H3 |
| InChIKey | QRFSJZKYXIWAIU-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.29 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-iodo-5-[3-(5-methyl-1,3-thiazol-2-yl)butyl]-3-propan-2-yl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iodo-5-[3-(5-methyl-1,3-thiazol-2-yl)butyl]-3-propan-2-yl-1,2-oxazole?
The IUPAC name of 4-iodo-5-[3-(5-methyl-1,3-thiazol-2-yl)butyl]-3-propan-2-yl-1,2-oxazole (CID 166727457) is 4-iodo-5-[3-(5-methyl-1,3-thiazol-2-yl)butyl]-3-propan-2-yl-1,2-oxazole.
What is the SMILES notation for 4-iodo-5-[3-(5-methyl-1,3-thiazol-2-yl)butyl]-3-propan-2-yl-1,2-oxazole?
The canonical SMILES for 4-iodo-5-[3-(5-methyl-1,3-thiazol-2-yl)butyl]-3-propan-2-yl-1,2-oxazole is Cc1cnc(C(C)CCc2onc(C(C)C)c2I)s1.
What is the InChIKey of 4-iodo-5-[3-(5-methyl-1,3-thiazol-2-yl)butyl]-3-propan-2-yl-1,2-oxazole?
The InChIKey is QRFSJZKYXIWAIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19IN2OS/c1-8(2)13-12(15)11(18-17-13)6-5-9(3)14-16-7-10(4)19-14/h7-9H,5-6H2,1-4H3.
What are the key properties of 4-iodo-5-[3-(5-methyl-1,3-thiazol-2-yl)butyl]-3-propan-2-yl-1,2-oxazole?
4-iodo-5-[3-(5-methyl-1,3-thiazol-2-yl)butyl]-3-propan-2-yl-1,2-oxazole has a molecular weight of 390.29 g/mol, XLogP of 4.90, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iodo-5-[3-(5-methyl-1,3-thiazol-2-yl)butyl]-3-propan-2-yl-1,2-oxazole is sourced from PubChem (CID 166727457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).