C18H15IN4 — CID 166728049
(1R)-1-[(3-iodo-2H-indazol-5-yl)amino]-4-methyl-2,3-dihydro-1H-indene-5-carbonitrile (PubChem CID 166728049) has the molecular formula C18H15IN4 and a molecular weight of 414.25 g/mol. Its IUPAC name is (1R)-1-[(3-iodo-2H-indazol-5-yl)amino]-4-methyl-2,3-dihydro-1H-indene-5-carbonitrile.
| Compound Name | (1R)-1-[(3-iodo-2H-indazol-5-yl)amino]-4-methyl-2,3-dihydro-1H-indene-5-carbonitrile |
|---|---|
| PubChem CID | 166728049 |
| Molecular Formula | C18H15IN4 |
| Molecular Weight | 414.25 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | (1R)-1-[(3-iodo-2H-indazol-5-yl)amino]-4-methyl-2,3-dihydro-1H-indene-5-carbonitrile |
| SMILES | Cc1c(C#N)ccc2c1CC[C@H]2Nc1ccc2n[nH]c(I)c2c1 |
| InChI | InChI=1S/C18H15IN4/c1-10-11(9-20)2-4-14-13(10)5-7-16(14)21-12-3-6-17-15(8-12)18(19)23-22-17/h2-4,6,8,16,21H,5,7H2,1H3,(H,22,23)/t16-/m1/s1 |
| InChIKey | HQXKRTLNBZAWQU-MRXNPFEDSA-N |
| XLogP | 4.45 |
| TPSA | 64.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.25 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|