C20H37N3O — CID 166728161
[(3Z)-9-methyl-8-(methylamino)-3-propylideneundeca-4,5-dienyl] (1Z)-N,N-dimethylethanehydrazonate (PubChem CID 166728161) has the molecular formula C20H37N3O and a molecular weight of 335.54 g/mol. Its IUPAC name is [(3Z)-9-methyl-8-(methylamino)-3-propylideneundeca-4,5-dienyl] (1Z)-N,N-dimethylethanehydrazonate.
| Compound Name | [(3Z)-9-methyl-8-(methylamino)-3-propylideneundeca-4,5-dienyl] (1Z)-N,N-dimethylethanehydrazonate |
|---|---|
| PubChem CID | 166728161 |
| Molecular Formula | C20H37N3O |
| Molecular Weight | 335.54 g/mol |
| Exact Mass | 335.29 |
| IUPAC Name | [(3Z)-9-methyl-8-(methylamino)-3-propylideneundeca-4,5-dienyl] (1Z)-N,N-dimethylethanehydrazonate |
| SMILES | CC/C=C(\C=C=CCC(NC)C(C)CC)CCO/C(C)=N\N(C)C |
| InChI | InChI=1S/C20H37N3O/c1-8-12-19(15-16-24-18(4)22-23(6)7)13-10-11-14-20(21-5)17(3)9-2/h11-13,17,20-21H,8-9,14-16H2,1-7H3/b19-12+,22-18- |
| InChIKey | KCPCTELWRZKSCC-OWMYFPPESA-N |
| XLogP | 4.36 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.54 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|