C27H29F3N4O2S — CID 166728377
4-[3-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]-4-(trifluoromethyl)phenyl]-2-methylbut-3-yn-2-ol (PubChem CID 166728377) has the molecular formula C27H29F3N4O2S and a molecular weight of 530.62 g/mol. Its IUPAC name is 4-[3-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]-4-(trifluoromethyl)phenyl]-2-methylbut-3-yn-2-ol.
| Compound Name | 4-[3-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]-4-(trifluoromethyl)phenyl]-2-methylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 166728377 |
| Molecular Formula | C27H29F3N4O2S |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | 4-[3-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]-4-(trifluoromethyl)phenyl]-2-methylbut-3-yn-2-ol |
| SMILES | CN1CCC(c2ncc(-c3cnc(N)c(OCc4cc(C#CC(C)(C)O)ccc4C(F)(F)F)c3)s2)CC1 |
| InChI | InChI=1S/C27H29F3N4O2S/c1-26(2,35)9-6-17-4-5-21(27(28,29)30)20(12-17)16-36-22-13-19(14-32-24(22)31)23-15-33-25(37-23)18-7-10-34(3)11-8-18/h4-5,12-15,18,35H,7-8,10-11,16H2,1-3H3,(H2,31,32) |
| InChIKey | DDUDIKKIMGMFIJ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|