C27H27FN4O2S — CID 166728426
2-[2-[3-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]phenyl]ethynyl]-4-fluorobicyclo[1.1.0]butan-2-ol (PubChem CID 166728426) has the molecular formula C27H27FN4O2S and a molecular weight of 490.60 g/mol. Its IUPAC name is 2-[2-[3-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]phenyl]ethynyl]-4-fluorobicyclo[1.1.0]butan-2-ol.
| Compound Name | 2-[2-[3-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]phenyl]ethynyl]-4-fluorobicyclo[1.1.0]butan-2-ol |
|---|---|
| PubChem CID | 166728426 |
| Molecular Formula | C27H27FN4O2S |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 2-[2-[3-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]phenyl]ethynyl]-4-fluorobicyclo[1.1.0]butan-2-ol |
| SMILES | CN1CCC(c2ncc(-c3cnc(N)c(OCc4cccc(C#CC5(O)C6C(F)C65)c4)c3)s2)CC1 |
| InChI | InChI=1S/C27H27FN4O2S/c1-32-9-6-18(7-10-32)26-31-14-21(35-26)19-12-20(25(29)30-13-19)34-15-17-4-2-3-16(11-17)5-8-27(33)22-23(27)24(22)28/h2-4,11-14,18,22-24,33H,6-7,9-10,15H2,1H3,(H2,29,30) |
| InChIKey | OAJOUICYKWKNFK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|