C19H19NO7 — CID 166728451
4-[[(1S)-9-hydroxy-3,5-dioxo-4-phenyl-4-azatricyclo[5.2.1.02,6]decan-8-yl]oxy]-4-oxobutanoic acid (PubChem CID 166728451) has the molecular formula C19H19NO7 and a molecular weight of 373.36 g/mol. Its IUPAC name is 4-[[(1S)-9-hydroxy-3,5-dioxo-4-phenyl-4-azatricyclo[5.2.1.02,6]decan-8-yl]oxy]-4-oxobutanoic acid.
| Compound Name | 4-[[(1S)-9-hydroxy-3,5-dioxo-4-phenyl-4-azatricyclo[5.2.1.02,6]decan-8-yl]oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 166728451 |
| Molecular Formula | C19H19NO7 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 4-[[(1S)-9-hydroxy-3,5-dioxo-4-phenyl-4-azatricyclo[5.2.1.02,6]decan-8-yl]oxy]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)OC1C2C[C@H](C1O)C1C(=O)N(c3ccccc3)C(=O)C21 |
| InChI | InChI=1S/C19H19NO7/c21-12(22)6-7-13(23)27-17-11-8-10(16(17)24)14-15(11)19(26)20(18(14)25)9-4-2-1-3-5-9/h1-5,10-11,14-17,24H,6-8H2,(H,21,22)/t10-,11?,14?,15?,16?,17?/m0/s1 |
| InChIKey | LEMYOKJVLYNEPO-CAIAJGCOSA-N |
| XLogP | 0.58 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|