C9H14N2 — CID 166728986
3-[(1Z)-buta-1,3-dienyl]-4-methyl-2,5-dihydropyrrol-1-amine (PubChem CID 166728986) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 3-[(1Z)-buta-1,3-dienyl]-4-methyl-2,5-dihydropyrrol-1-amine.
| Compound Name | 3-[(1Z)-buta-1,3-dienyl]-4-methyl-2,5-dihydropyrrol-1-amine |
|---|---|
| PubChem CID | 166728986 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 3-[(1Z)-buta-1,3-dienyl]-4-methyl-2,5-dihydropyrrol-1-amine |
| SMILES | C=C/C=C\C1=C(C)CN(N)C1 |
| InChI | InChI=1S/C9H14N2/c1-3-4-5-9-7-11(10)6-8(9)2/h3-5H,1,6-7,10H2,2H3/b5-4- |
| InChIKey | MXGBCNUZIDCRDC-PLNGDYQASA-N |
| XLogP | 1.23 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|