About 9-amino-9-(5-bromo-1,3-oxazol-2-yl)nonan-3-one;hydrochloride
9-amino-9-(5-bromo-1,3-oxazol-2-yl)nonan-3-one;hydrochloride (PubChem CID 166729365) has the molecular formula C12H20BrClN2O2
and a molecular weight of 339.66 g/mol. Its IUPAC name is 9-amino-9-(5-bromo-1,3-oxazol-2-yl)nonan-3-one;hydrochloride.
Molecular Properties
| Compound Name | 9-amino-9-(5-bromo-1,3-oxazol-2-yl)nonan-3-one;hydrochloride |
| PubChem CID | 166729365 |
| Molecular Formula | C12H20BrClN2O2 |
| Molecular Weight | 339.66 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 9-amino-9-(5-bromo-1,3-oxazol-2-yl)nonan-3-one;hydrochloride |
| SMILES | CCC(=O)CCCCCC(N)c1ncc(Br)o1.Cl |
| InChI | InChI=1S/C12H19BrN2O2.ClH/c1-2-9(16)6-4-3-5-7-10(14)12-15-8-11(13)17-12;/h8,10H,2-7,14H2,1H3;1H |
| InChIKey | UVFONOMNBUCLGL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.66 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-amino-9-(5-bromo-1,3-oxazol-2-yl)nonan-3-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-amino-9-(5-bromo-1,3-oxazol-2-yl)nonan-3-one;hydrochloride?
The IUPAC name of 9-amino-9-(5-bromo-1,3-oxazol-2-yl)nonan-3-one;hydrochloride (CID 166729365) is 9-amino-9-(5-bromo-1,3-oxazol-2-yl)nonan-3-one;hydrochloride.
What is the SMILES notation for 9-amino-9-(5-bromo-1,3-oxazol-2-yl)nonan-3-one;hydrochloride?
The canonical SMILES for 9-amino-9-(5-bromo-1,3-oxazol-2-yl)nonan-3-one;hydrochloride is CCC(=O)CCCCCC(N)c1ncc(Br)o1.Cl.
What is the InChIKey of 9-amino-9-(5-bromo-1,3-oxazol-2-yl)nonan-3-one;hydrochloride?
The InChIKey is UVFONOMNBUCLGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19BrN2O2.ClH/c1-2-9(16)6-4-3-5-7-10(14)12-15-8-11(13)17-12;/h8,10H,2-7,14H2,1H3;1H.
What are the key properties of 9-amino-9-(5-bromo-1,3-oxazol-2-yl)nonan-3-one;hydrochloride?
9-amino-9-(5-bromo-1,3-oxazol-2-yl)nonan-3-one;hydrochloride has a molecular weight of 339.66 g/mol, XLogP of 3.79, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-amino-9-(5-bromo-1,3-oxazol-2-yl)nonan-3-one;hydrochloride is sourced from PubChem (CID 166729365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).