About 4-phenylbenzenesulfonic acid
4-phenylbenzenesulfonic acid (PubChem CID 16673) has the molecular formula C12H10O3S
and a molecular weight of 234.28 g/mol. Its IUPAC name is 4-phenylbenzenesulfonic acid.
Molecular Properties
| Compound Name | 4-phenylbenzenesulfonic acid |
| PubChem CID | 16673 |
| Molecular Formula | C12H10O3S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | 4-phenylbenzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10O3S/c13-16(14,15)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H,(H,13,14,15) |
| InChIKey | XDTYUYVIGLIFCW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-phenylbenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylbenzenesulfonic acid?
The IUPAC name of 4-phenylbenzenesulfonic acid (CID 16673) is 4-phenylbenzenesulfonic acid.
What is the SMILES notation for 4-phenylbenzenesulfonic acid?
The canonical SMILES for 4-phenylbenzenesulfonic acid is O=S(=O)(O)c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 4-phenylbenzenesulfonic acid?
The InChIKey is XDTYUYVIGLIFCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O3S/c13-16(14,15)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H,(H,13,14,15).
What are the key properties of 4-phenylbenzenesulfonic acid?
4-phenylbenzenesulfonic acid has a molecular weight of 234.28 g/mol, XLogP of 2.60, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylbenzenesulfonic acid is sourced from PubChem (CID 16673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).