About N-ethyl-3-(2,4,4-trimethylpentan-2-yl)oxiran-2-amine
N-ethyl-3-(2,4,4-trimethylpentan-2-yl)oxiran-2-amine (PubChem CID 166730050) has the molecular formula C12H25NO
and a molecular weight of 199.34 g/mol. Its IUPAC name is N-ethyl-3-(2,4,4-trimethylpentan-2-yl)oxiran-2-amine.
Molecular Properties
| Compound Name | N-ethyl-3-(2,4,4-trimethylpentan-2-yl)oxiran-2-amine |
| PubChem CID | 166730050 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | N-ethyl-3-(2,4,4-trimethylpentan-2-yl)oxiran-2-amine |
| SMILES | CCNC1OC1C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C12H25NO/c1-7-13-10-9(14-10)12(5,6)8-11(2,3)4/h9-10,13H,7-8H2,1-6H3 |
| InChIKey | IRFGBHQPAFYBNJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 24.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-3-(2,4,4-trimethylpentan-2-yl)oxiran-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-3-(2,4,4-trimethylpentan-2-yl)oxiran-2-amine?
The IUPAC name of N-ethyl-3-(2,4,4-trimethylpentan-2-yl)oxiran-2-amine (CID 166730050) is N-ethyl-3-(2,4,4-trimethylpentan-2-yl)oxiran-2-amine.
What is the SMILES notation for N-ethyl-3-(2,4,4-trimethylpentan-2-yl)oxiran-2-amine?
The canonical SMILES for N-ethyl-3-(2,4,4-trimethylpentan-2-yl)oxiran-2-amine is CCNC1OC1C(C)(C)CC(C)(C)C.
What is the InChIKey of N-ethyl-3-(2,4,4-trimethylpentan-2-yl)oxiran-2-amine?
The InChIKey is IRFGBHQPAFYBNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO/c1-7-13-10-9(14-10)12(5,6)8-11(2,3)4/h9-10,13H,7-8H2,1-6H3.
What are the key properties of N-ethyl-3-(2,4,4-trimethylpentan-2-yl)oxiran-2-amine?
N-ethyl-3-(2,4,4-trimethylpentan-2-yl)oxiran-2-amine has a molecular weight of 199.34 g/mol, XLogP of 2.78, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-3-(2,4,4-trimethylpentan-2-yl)oxiran-2-amine is sourced from PubChem (CID 166730050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).