About (1S,4Z)-5-[amino(propan-2-yl)amino]-8-methylcyclooct-4-ene-1,4-diamine
(1S,4Z)-5-[amino(propan-2-yl)amino]-8-methylcyclooct-4-ene-1,4-diamine (PubChem CID 166730144) has the molecular formula C12H26N4
and a molecular weight of 226.37 g/mol. Its IUPAC name is (1S,4Z)-5-[amino(propan-2-yl)amino]-8-methylcyclooct-4-ene-1,4-diamine.
Molecular Properties
| Compound Name | (1S,4Z)-5-[amino(propan-2-yl)amino]-8-methylcyclooct-4-ene-1,4-diamine |
| PubChem CID | 166730144 |
| Molecular Formula | C12H26N4 |
| Molecular Weight | 226.37 g/mol |
| Exact Mass | 226.22 |
| IUPAC Name | (1S,4Z)-5-[amino(propan-2-yl)amino]-8-methylcyclooct-4-ene-1,4-diamine |
| SMILES | CC1CC/C(N(N)C(C)C)=C(/N)CC[C@@H]1N |
| InChI | InChI=1S/C12H26N4/c1-8(2)16(15)12-7-4-9(3)10(13)5-6-11(12)14/h8-10H,4-7,13-15H2,1-3H3/b12-11-/t9?,10-/m0/s1 |
| InChIKey | AMVNCQKKBNNQAL-MHXZTGGQSA-N |
| XLogP | 1.28 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.37 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1S,4Z)-5-[amino(propan-2-yl)amino]-8-methylcyclooct-4-ene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,4Z)-5-[amino(propan-2-yl)amino]-8-methylcyclooct-4-ene-1,4-diamine?
The IUPAC name of (1S,4Z)-5-[amino(propan-2-yl)amino]-8-methylcyclooct-4-ene-1,4-diamine (CID 166730144) is (1S,4Z)-5-[amino(propan-2-yl)amino]-8-methylcyclooct-4-ene-1,4-diamine.
What is the SMILES notation for (1S,4Z)-5-[amino(propan-2-yl)amino]-8-methylcyclooct-4-ene-1,4-diamine?
The canonical SMILES for (1S,4Z)-5-[amino(propan-2-yl)amino]-8-methylcyclooct-4-ene-1,4-diamine is CC1CC/C(N(N)C(C)C)=C(/N)CC[C@@H]1N.
What is the InChIKey of (1S,4Z)-5-[amino(propan-2-yl)amino]-8-methylcyclooct-4-ene-1,4-diamine?
The InChIKey is AMVNCQKKBNNQAL-MHXZTGGQSA-N. The full InChI is InChI=1S/C12H26N4/c1-8(2)16(15)12-7-4-9(3)10(13)5-6-11(12)14/h8-10H,4-7,13-15H2,1-3H3/b12-11-/t9?,10-/m0/s1.
What are the key properties of (1S,4Z)-5-[amino(propan-2-yl)amino]-8-methylcyclooct-4-ene-1,4-diamine?
(1S,4Z)-5-[amino(propan-2-yl)amino]-8-methylcyclooct-4-ene-1,4-diamine has a molecular weight of 226.37 g/mol, XLogP of 1.28, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,4Z)-5-[amino(propan-2-yl)amino]-8-methylcyclooct-4-ene-1,4-diamine is sourced from PubChem (CID 166730144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).