About 4-methyl-4'-[3-(methylamino)pyrrolidin-1-yl]spiro[1H-indole-3,1'-cyclohexane]-2-one
4-methyl-4'-[3-(methylamino)pyrrolidin-1-yl]spiro[1H-indole-3,1'-cyclohexane]-2-one (PubChem CID 166730181) has the molecular formula C19H27N3O
and a molecular weight of 313.44 g/mol. Its IUPAC name is 4-methyl-4'-[3-(methylamino)pyrrolidin-1-yl]spiro[1H-indole-3,1'-cyclohexane]-2-one.
Molecular Properties
| Compound Name | 4-methyl-4'-[3-(methylamino)pyrrolidin-1-yl]spiro[1H-indole-3,1'-cyclohexane]-2-one |
| PubChem CID | 166730181 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | 4-methyl-4'-[3-(methylamino)pyrrolidin-1-yl]spiro[1H-indole-3,1'-cyclohexane]-2-one |
| SMILES | CNC1CCN(C2CCC3(CC2)C(=O)Nc2cccc(C)c23)C1 |
| InChI | InChI=1S/C19H27N3O/c1-13-4-3-5-16-17(13)19(18(23)21-16)9-6-15(7-10-19)22-11-8-14(12-22)20-2/h3-5,14-15,20H,6-12H2,1-2H3,(H,21,23) |
| InChIKey | PLDXSDBGGRPJMB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-4'-[3-(methylamino)pyrrolidin-1-yl]spiro[1H-indole-3,1'-cyclohexane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-4'-[3-(methylamino)pyrrolidin-1-yl]spiro[1H-indole-3,1'-cyclohexane]-2-one?
The IUPAC name of 4-methyl-4'-[3-(methylamino)pyrrolidin-1-yl]spiro[1H-indole-3,1'-cyclohexane]-2-one (CID 166730181) is 4-methyl-4'-[3-(methylamino)pyrrolidin-1-yl]spiro[1H-indole-3,1'-cyclohexane]-2-one.
What is the SMILES notation for 4-methyl-4'-[3-(methylamino)pyrrolidin-1-yl]spiro[1H-indole-3,1'-cyclohexane]-2-one?
The canonical SMILES for 4-methyl-4'-[3-(methylamino)pyrrolidin-1-yl]spiro[1H-indole-3,1'-cyclohexane]-2-one is CNC1CCN(C2CCC3(CC2)C(=O)Nc2cccc(C)c23)C1.
What is the InChIKey of 4-methyl-4'-[3-(methylamino)pyrrolidin-1-yl]spiro[1H-indole-3,1'-cyclohexane]-2-one?
The InChIKey is PLDXSDBGGRPJMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27N3O/c1-13-4-3-5-16-17(13)19(18(23)21-16)9-6-15(7-10-19)22-11-8-14(12-22)20-2/h3-5,14-15,20H,6-12H2,1-2H3,(H,21,23).
What are the key properties of 4-methyl-4'-[3-(methylamino)pyrrolidin-1-yl]spiro[1H-indole-3,1'-cyclohexane]-2-one?
4-methyl-4'-[3-(methylamino)pyrrolidin-1-yl]spiro[1H-indole-3,1'-cyclohexane]-2-one has a molecular weight of 313.44 g/mol, XLogP of 2.42, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-4'-[3-(methylamino)pyrrolidin-1-yl]spiro[1H-indole-3,1'-cyclohexane]-2-one is sourced from PubChem (CID 166730181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).