About (7Z)-6,6-dimethyl-1,4-diazacycloocta-1,2,4,7-tetraene
(7Z)-6,6-dimethyl-1,4-diazacycloocta-1,2,4,7-tetraene (PubChem CID 166730217) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is (7Z)-6,6-dimethyl-1,4-diazacycloocta-1,2,4,7-tetraene.
Analyze (7Z)-6,6-dimethyl-1,4-diazacycloocta-1,2,4,7-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7Z)-6,6-dimethyl-1,4-diazacycloocta-1,2,4,7-tetraene?
The IUPAC name of (7Z)-6,6-dimethyl-1,4-diazacycloocta-1,2,4,7-tetraene (CID 166730217) is (7Z)-6,6-dimethyl-1,4-diazacycloocta-1,2,4,7-tetraene.
What is the SMILES notation for (7Z)-6,6-dimethyl-1,4-diazacycloocta-1,2,4,7-tetraene?
The canonical SMILES for (7Z)-6,6-dimethyl-1,4-diazacycloocta-1,2,4,7-tetraene is CC1(C)/C=C\N=C=C/N=C\1.
What is the InChIKey of (7Z)-6,6-dimethyl-1,4-diazacycloocta-1,2,4,7-tetraene?
The InChIKey is CAXFYZWHTFZJSU-ZJSQCTGTSA-N. The full InChI is InChI=1S/C8H10N2/c1-8(2)3-4-9-5-6-10-7-8/h3-4,6-7H,1-2H3/b4-3-,10-7-.
What are the key properties of (7Z)-6,6-dimethyl-1,4-diazacycloocta-1,2,4,7-tetraene?
(7Z)-6,6-dimethyl-1,4-diazacycloocta-1,2,4,7-tetraene has a molecular weight of 134.18 g/mol, XLogP of 1.79, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7Z)-6,6-dimethyl-1,4-diazacycloocta-1,2,4,7-tetraene is sourced from PubChem (CID 166730217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).