About N-[(Z)-4-imino-2,3-dimethylpent-2-enyl]-6-methyloctan-3-amine
N-[(Z)-4-imino-2,3-dimethylpent-2-enyl]-6-methyloctan-3-amine (PubChem CID 166730580) has the molecular formula C16H32N2
and a molecular weight of 252.45 g/mol. Its IUPAC name is N-[(Z)-4-imino-2,3-dimethylpent-2-enyl]-6-methyloctan-3-amine.
Molecular Properties
| Compound Name | N-[(Z)-4-imino-2,3-dimethylpent-2-enyl]-6-methyloctan-3-amine |
| PubChem CID | 166730580 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | N-[(Z)-4-imino-2,3-dimethylpent-2-enyl]-6-methyloctan-3-amine |
| SMILES | [H]/N=C(C)/C(C)=C(/C)CNC(CC)CCC(C)CC |
| InChI | InChI=1S/C16H32N2/c1-7-12(3)9-10-16(8-2)18-11-13(4)14(5)15(6)17/h12,16-18H,7-11H2,1-6H3/b14-13-,17-15+ |
| InChIKey | MCZZAWXVDYTYAG-IWHORCFHSA-N |
| XLogP | 4.56 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-4-imino-2,3-dimethylpent-2-enyl]-6-methyloctan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-4-imino-2,3-dimethylpent-2-enyl]-6-methyloctan-3-amine?
The IUPAC name of N-[(Z)-4-imino-2,3-dimethylpent-2-enyl]-6-methyloctan-3-amine (CID 166730580) is N-[(Z)-4-imino-2,3-dimethylpent-2-enyl]-6-methyloctan-3-amine.
What is the SMILES notation for N-[(Z)-4-imino-2,3-dimethylpent-2-enyl]-6-methyloctan-3-amine?
The canonical SMILES for N-[(Z)-4-imino-2,3-dimethylpent-2-enyl]-6-methyloctan-3-amine is [H]/N=C(C)/C(C)=C(/C)CNC(CC)CCC(C)CC.
What is the InChIKey of N-[(Z)-4-imino-2,3-dimethylpent-2-enyl]-6-methyloctan-3-amine?
The InChIKey is MCZZAWXVDYTYAG-IWHORCFHSA-N. The full InChI is InChI=1S/C16H32N2/c1-7-12(3)9-10-16(8-2)18-11-13(4)14(5)15(6)17/h12,16-18H,7-11H2,1-6H3/b14-13-,17-15+.
What are the key properties of N-[(Z)-4-imino-2,3-dimethylpent-2-enyl]-6-methyloctan-3-amine?
N-[(Z)-4-imino-2,3-dimethylpent-2-enyl]-6-methyloctan-3-amine has a molecular weight of 252.45 g/mol, XLogP of 4.56, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-4-imino-2,3-dimethylpent-2-enyl]-6-methyloctan-3-amine is sourced from PubChem (CID 166730580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).