C21H26N4O2 — CID 16673120
8-ethoxy-2-[[2-(2-methoxyethyl)pyrimidin-5-yl]methyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole (PubChem CID 16673120) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is 8-ethoxy-2-[[2-(2-methoxyethyl)pyrimidin-5-yl]methyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole.
| Compound Name | 8-ethoxy-2-[[2-(2-methoxyethyl)pyrimidin-5-yl]methyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 16673120 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 8-ethoxy-2-[[2-(2-methoxyethyl)pyrimidin-5-yl]methyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole |
| SMILES | CCOc1ccc2[nH]c3c(c2c1)CN(Cc1cnc(CCOC)nc1)CC3 |
| InChI | InChI=1S/C21H26N4O2/c1-3-27-16-4-5-19-17(10-16)18-14-25(8-6-20(18)24-19)13-15-11-22-21(23-12-15)7-9-26-2/h4-5,10-12,24H,3,6-9,13-14H2,1-2H3 |
| InChIKey | YGLZSAUKVMTSKG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|