About gold(1+);triethylphosphane;azide
gold(1+);triethylphosphane;azide (PubChem CID 166731387) has the molecular formula C6H15AuN3P
and a molecular weight of 357.15 g/mol. Its IUPAC name is gold(1+);triethylphosphane;azide.
Molecular Properties
| Compound Name | gold(1+);triethylphosphane;azide |
| PubChem CID | 166731387 |
| Molecular Formula | C6H15AuN3P |
| Molecular Weight | 357.15 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | gold(1+);triethylphosphane;azide |
| SMILES | CCP(CC)CC.[Au+].[N-]=[N+]=[N-] |
| InChI | InChI=1S/C6H15P.Au.N3/c1-4-7(5-2)6-3;;1-3-2/h4-6H2,1-3H3;;/q;+1;-1 |
| InChIKey | DUOFGMCNFMZASV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 58.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.15 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze gold(1+);triethylphosphane;azide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gold(1+);triethylphosphane;azide?
The IUPAC name of gold(1+);triethylphosphane;azide (CID 166731387) is gold(1+);triethylphosphane;azide.
What is the SMILES notation for gold(1+);triethylphosphane;azide?
The canonical SMILES for gold(1+);triethylphosphane;azide is CCP(CC)CC.[Au+].[N-]=[N+]=[N-].
What is the InChIKey of gold(1+);triethylphosphane;azide?
The InChIKey is DUOFGMCNFMZASV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15P.Au.N3/c1-4-7(5-2)6-3;;1-3-2/h4-6H2,1-3H3;;/q;+1;-1.
What are the key properties of gold(1+);triethylphosphane;azide?
gold(1+);triethylphosphane;azide has a molecular weight of 357.15 g/mol, XLogP of 3.39, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for gold(1+);triethylphosphane;azide is sourced from PubChem (CID 166731387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).