About 4-chloro-N-(2,2-diethoxyacetyl)benzohydrazide
4-chloro-N-(2,2-diethoxyacetyl)benzohydrazide (PubChem CID 166732224) has the molecular formula C13H17ClN2O4
and a molecular weight of 300.74 g/mol. Its IUPAC name is 4-chloro-N-(2,2-diethoxyacetyl)benzohydrazide.
Molecular Properties
| Compound Name | 4-chloro-N-(2,2-diethoxyacetyl)benzohydrazide |
| PubChem CID | 166732224 |
| Molecular Formula | C13H17ClN2O4 |
| Molecular Weight | 300.74 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 4-chloro-N-(2,2-diethoxyacetyl)benzohydrazide |
| SMILES | CCOC(OCC)C(=O)N(N)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H17ClN2O4/c1-3-19-13(20-4-2)12(18)16(15)11(17)9-5-7-10(14)8-6-9/h5-8,13H,3-4,15H2,1-2H3 |
| InChIKey | QDSCUXWJOXFOFN-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.74 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-N-(2,2-diethoxyacetyl)benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-(2,2-diethoxyacetyl)benzohydrazide?
The IUPAC name of 4-chloro-N-(2,2-diethoxyacetyl)benzohydrazide (CID 166732224) is 4-chloro-N-(2,2-diethoxyacetyl)benzohydrazide.
What is the SMILES notation for 4-chloro-N-(2,2-diethoxyacetyl)benzohydrazide?
The canonical SMILES for 4-chloro-N-(2,2-diethoxyacetyl)benzohydrazide is CCOC(OCC)C(=O)N(N)C(=O)c1ccc(Cl)cc1.
What is the InChIKey of 4-chloro-N-(2,2-diethoxyacetyl)benzohydrazide?
The InChIKey is QDSCUXWJOXFOFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClN2O4/c1-3-19-13(20-4-2)12(18)16(15)11(17)9-5-7-10(14)8-6-9/h5-8,13H,3-4,15H2,1-2H3.
What are the key properties of 4-chloro-N-(2,2-diethoxyacetyl)benzohydrazide?
4-chloro-N-(2,2-diethoxyacetyl)benzohydrazide has a molecular weight of 300.74 g/mol, XLogP of 1.58, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-(2,2-diethoxyacetyl)benzohydrazide is sourced from PubChem (CID 166732224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).